Products 2517796-20-0
CAS 2517796-20-0 is the registry number for (R)-Valiltramiprosate . Offered by: TRC. Available pack sizes: 250mg.
3-[[(2R)-2-amino-3-methylbutanoyl]amino]propane-1-sulfonic acid (CAS 2517796-20-0) is a chemical compound with the molecular formula C8H18N2O4S and a molecular weight of 238.31 g/mol. IUPAC name: 3-[[(2R)-2-amino-3-methylbutanoyl]amino]propane-1-sulfonic acid. InChIKey: NRZRFNYKMSAZBI-SSDOTTSWSA-N.
| Molecular formula | C8H18N2O4S |
|---|---|
| Molecular weight | 238.31 g/mol |
| IUPAC name | 3-[[(2R)-2-amino-3-methylbutanoyl]amino]propane-1-sulfonic acid |
| InChIKey | NRZRFNYKMSAZBI-SSDOTTSWSA-N |
| SMILES | CC(C)[C@H](C(=O)NCCCS(=O)(=O)O)N |
Computed by PubChem (NCBI)
Synonyms:
(R)-Valiltramiprosate