cas: 58479-55-3 — see every product listed under this CAS number, including other names
Butanoic acid, (1R,2R,4R)-1,7,7-trimethylbicyclo[2.2.1]hept-2-yl ester, rel-, 95%, 95% (CAS 58479-55-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11E04Z-100mg |
| cas | 58479-55-3 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 462.80 Pln | |
| Chemat | 250mg | 736.40 Pln | |
| Chemat | 1g | 1442.00 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[(1R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] butanoate (CAS 58479-55-3) is a chemical compound with the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. IUPAC name: [(1R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] butanoate. InChIKey: ALPQPFVDVBJLHC-IFQILLTASA-N.
| Molecular formula | C14H24O2 |
|---|---|
| Molecular weight | 224.34 g/mol |
| IUPAC name | [(1R)-4,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl] butanoate |
| InChIKey | ALPQPFVDVBJLHC-IFQILLTASA-N |
| SMILES | CCCC(=O)OC1CC2(CC[C@@H]1C2(C)C)C |
Computed by PubChem (NCBI)