CAS 52034-92-1 appears in our catalog under these names: Dicyclohexylacetic acid, 98%, 2,2-Dicyclohexylacetic acid, 98%, Dicyclohexylacetic acid, 98+% , Dicyclohexylacetic acid, DICYCLOHEXYLACETIC ACID, 99%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g, 0,25g, 2,5g, 10g.
2,2-dicyclohexylacetic acid (CAS 52034-92-1) is a chemical compound with the molecular formula C14H24O2 and a molecular weight of 224.34 g/mol. IUPAC name: 2,2-dicyclohexylacetic acid. InChIKey: PGGMEZOUAPIYOY-UHFFFAOYSA-N.
| Molecular formula | C14H24O2 |
|---|---|
| Molecular weight | 224.34 g/mol |
| IUPAC name | 2,2-dicyclohexylacetic acid |
| InChIKey | PGGMEZOUAPIYOY-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(C2CCCCC2)C(=O)O |
Computed by PubChem (NCBI)