cas: 135236-72-5 — see every product listed under this CAS number, including other names
Butanoic acid, 3-hydroxy-3-methyl-, calcium salt (2:1), 99%, 99% (CAS 135236-72-5) is a chemical reagent available from Chemat. Available pack sizes: 25g, 100g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114ONL-25g |
| cas | 135236-72-5 |
| size | 25g |
| availability | 3500g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 25g | 83.60 Pln | |
| Chemat | 100g | 98.00 Pln | |
| Chemat | 500g | 273.60 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
Calcium bis(3-hydroxy-3-methylbutanoate) (CAS 135236-72-5) is a chemical compound with the molecular formula C10H18CaO6 and a molecular weight of 274.32 g/mol. IUPAC name: calcium bis(3-hydroxy-3-methylbutanoate). InChIKey: WLJUMPWVUPNXMF-UHFFFAOYSA-L.
| Molecular formula | C10H18CaO6 |
|---|---|
| Molecular weight | 274.32 g/mol |
| IUPAC name | calcium bis(3-hydroxy-3-methylbutanoate) |
| InChIKey | WLJUMPWVUPNXMF-UHFFFAOYSA-L |
| SMILES | CC(C)(CC(=O)[O-])O.CC(C)(CC(=O)[O-])O.[Ca+2] |
Computed by PubChem (NCBI)