Products 132741-56-1
CAS 132741-56-1 appears in our catalog under these names: Butyl chlorogenate/ 98%, Chlorogenic acid butyl ester, 98.19%, Butyl chlorogenate. Offered by: TargetMol, MedChemExpress, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg, 10 mg.
Butyl (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate (CAS 132741-56-1) is a chemical compound with the molecular formula C20H26O9 and a molecular weight of 410.4 g/mol. IUPAC name: butyl (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate. InChIKey: VNLREARKISTOAD-SNQQTVKYSA-N.
| Molecular formula | C20H26O9 |
|---|---|
| Molecular weight | 410.4 g/mol |
| IUPAC name | butyl (1S,3R,4R,5R)-3-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-1,4,5-trihydroxycyclohexane-1-carboxylate |
| InChIKey | VNLREARKISTOAD-SNQQTVKYSA-N |
| SMILES | CCCCOC(=O)[C@@]1(C[C@H]([C@H]([C@@H](C1)OC(=O)/C=C/C2=CC(=C(C=C2)O)O)O)O)O |
Computed by PubChem (NCBI)