CAS 178946-89-9 appears in our catalog under these names: C-DIM12/ 99.15% (existing batch purity), C–DIM12, C-DIM 12, >98.0%(HPLC)(qNMR), C-DIM12 98%, C-DIM12, 98%, 98%. Offered by: TargetMol, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1g, 5mg, 500mg.
3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-1H-indole (CAS 178946-89-9) is a chemical compound with the molecular formula C23H17ClN2 and a molecular weight of 356.8 g/mol. IUPAC name: 3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-1H-indole. InChIKey: LTLRXTDMXOFBDW-UHFFFAOYSA-N.
| Molecular formula | C23H17ClN2 |
|---|---|
| Molecular weight | 356.8 g/mol |
| IUPAC name | 3-[(4-chlorophenyl)-(1H-indol-3-yl)methyl]-1H-indole |
| InChIKey | LTLRXTDMXOFBDW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN2)C(C3=CC=C(C=C3)Cl)C4=CNC5=CC=CC=C54 |
Computed by PubChem (NCBI)