CAS 334668-69-8 appears in our catalog under these names: CB1R antagonist 1/ 99.65% (existing batch purity), CB1R antagonist 1, CB1R antagonist 1, 98%, 98%, CB1R antagonist 1, 99.89%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 5 mg, 10 mg.
Cyclohexyl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone (CAS 334668-69-8) is a chemical compound with the molecular formula C18H23F3N2O3S and a molecular weight of 404.4 g/mol. IUPAC name: cyclohexyl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone. InChIKey: CRXJBISLCDTJDM-UHFFFAOYSA-N.
| Molecular formula | C18H23F3N2O3S |
|---|---|
| Molecular weight | 404.4 g/mol |
| IUPAC name | cyclohexyl-[4-[3-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]methanone |
| InChIKey | CRXJBISLCDTJDM-UHFFFAOYSA-N |
| SMILES | C1CCC(CC1)C(=O)N2CCN(CC2)S(=O)(=O)C3=CC=CC(=C3)C(F)(F)F |
Computed by PubChem (NCBI)