CAS 206275-15-2 appears in our catalog under these names: CB30865, 99+%, CB30865/ 98.75% (existing batch purity), CB30865, Cb-30865, 99.04% ,, 99.04% ,, CB30865, 98.75%. Offered by: AmBeed, TargetMol, GLPBio, Biosynth, Chemat. Available pack sizes: 50mg, 2mg, 10mg, 100mg, 5mg, 10mM (in 1ml dmso), 25mg, 50 mg.
4-[(7-bromo-2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-N-(pyridin-3-ylmethyl)benzamide (CAS 206275-15-2) is a chemical compound with the molecular formula C26H22BrN5O2 and a molecular weight of 516.4 g/mol. IUPAC name: 4-[(7-bromo-2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-N-(pyridin-3-ylmethyl)benzamide. InChIKey: SHNBLWMBWXIKMR-UHFFFAOYSA-N.
| Molecular formula | C26H22BrN5O2 |
|---|---|
| Molecular weight | 516.4 g/mol |
| IUPAC name | 4-[(7-bromo-2-methyl-4-oxo-3H-quinazolin-6-yl)methyl-prop-2-ynylamino]-N-(pyridin-3-ylmethyl)benzamide |
| InChIKey | SHNBLWMBWXIKMR-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C(C(=C2)Br)CN(CC#C)C3=CC=C(C=C3)C(=O)NCC4=CN=CC=C4)C(=O)N1 |
Computed by PubChem (NCBI)