CAS 2443789-32-8 appears in our catalog under these names: CBP/p300–IN–1, CBP/EP300-IN-1/ 98%, Cbp/ep300-in-1, CBP/p300-IN-1, 98%, 98%, CBP/p300-IN-1, 99.71%. Offered by: GLPBio, TargetMol, Biosynth, Chemat, MedChemExpress. Available pack sizes: 10mg, 100mg, 10mM (in 1ml dmso), 25mg, 5mg, 50mg, 1mg, 200mg.
Tert-butyl 3-[(1-acetyl-5-methoxyindole-3-carbonyl)amino]-4-fluorobenzoate (CAS 2443789-32-8) is a chemical compound with the molecular formula C23H23FN2O5 and a molecular weight of 426.4 g/mol. IUPAC name: tert-butyl 3-[(1-acetyl-5-methoxyindole-3-carbonyl)amino]-4-fluorobenzoate. InChIKey: BNTANBUTBDVIHY-UHFFFAOYSA-N.
| Molecular formula | C23H23FN2O5 |
|---|---|
| Molecular weight | 426.4 g/mol |
| IUPAC name | tert-butyl 3-[(1-acetyl-5-methoxyindole-3-carbonyl)amino]-4-fluorobenzoate |
| InChIKey | BNTANBUTBDVIHY-UHFFFAOYSA-N |
| SMILES | CC(=O)N1C=C(C2=C1C=CC(=C2)OC)C(=O)NC3=C(C=CC(=C3)C(=O)OC(C)(C)C)F |
Computed by PubChem (NCBI)