CAS 856702-40-4 appears in our catalog under these names: CBiPES hydrochloride/ 99.66% (existing batch purity), CBiPES hydrochloride, CBiPES HCl 99%, CBIPES HYDROCHLORIDE, N-(4'-Cyano-[1,1'-biphenyl]-3-yl)-N-(pyridin-3-ylmethyl)ethanesulfonamide hydrochloride, 95%, 95%. Offered by: TargetMol, GLPBio, Ambeed, Sigma-Aldrich, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 5 mg.
N-[3-(4-cyanophenyl)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide;hydrochloride (CAS 856702-40-4) is a chemical compound with the molecular formula C21H20ClN3O2S and a molecular weight of 413.9 g/mol. IUPAC name: N-[3-(4-cyanophenyl)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide;hydrochloride. InChIKey: QKUHSVQWWZBAKM-UHFFFAOYSA-N.
| Molecular formula | C21H20ClN3O2S |
|---|---|
| Molecular weight | 413.9 g/mol |
| IUPAC name | N-[3-(4-cyanophenyl)phenyl]-N-(pyridin-3-ylmethyl)ethanesulfonamide;hydrochloride |
| InChIKey | QKUHSVQWWZBAKM-UHFFFAOYSA-N |
| SMILES | CCS(=O)(=O)N(CC1=CN=CC=C1)C2=CC=CC(=C2)C3=CC=C(C=C3)C#N.Cl |
Computed by PubChem (NCBI)