cas: 1347750-74-6 — see every product listed under this CAS number, including other names
CBz-n-amido-peg5-acid, 99%, 99% (CAS 1347750-74-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HTSA-250mg |
| cas | 1347750-74-6 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 150.80 Pln | |
| Chemat | 1g | 304.40 Pln | |
| Chemat | 5g | 904.40 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
3-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-74-6) is a chemical compound with the molecular formula C21H33NO9 and a molecular weight of 443.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: XDNKBFYOBNNSEF-UHFFFAOYSA-N.
| Molecular formula | C21H33NO9 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | XDNKBFYOBNNSEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)