Products 1347750-74-6
CAS 1347750-74-6 appears in our catalog under these names: Cbz-n-amido-peg5-acid, 95%, Cbz-N-Amido-PEG5-Acid, CBz–n–amido–peg5–acid, Cbz-NH-PEG5-C2-acid, CBz-n-amido-peg5-acid, 99%, 99%. Offered by: Combi-blocks, TRC, GLPBio, MedChemExpress, Chemat. Available pack sizes: 250mg, 1g, 500mg, 250 mg, 5 g, 1 g, 5g.
3-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid (CAS 1347750-74-6) is a chemical compound with the molecular formula C21H33NO9 and a molecular weight of 443.5 g/mol. IUPAC name: 3-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid. InChIKey: XDNKBFYOBNNSEF-UHFFFAOYSA-N.
| Molecular formula | C21H33NO9 |
|---|---|
| Molecular weight | 443.5 g/mol |
| IUPAC name | 3-[2-[2-[2-[2-[2-(phenylmethoxycarbonylamino)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]propanoic acid |
| InChIKey | XDNKBFYOBNNSEF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NCCOCCOCCOCCOCCOCCC(=O)O |
Computed by PubChem (NCBI)