Products 1621999-82-3
CAS 1621999-82-3 appears in our catalog under these names: CC-90003/ 99.14% (existing batch purity), CC–90003, CC-90003 99%, CC-90003, 99%, 99%, CC-90003, 99.50%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 250mg.
N-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide (CAS 1621999-82-3) is a chemical compound with the molecular formula C22H21F3N6O2 and a molecular weight of 458.4 g/mol. IUPAC name: N-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide. InChIKey: ILUKRINUNLAVMH-UHFFFAOYSA-N.
| Molecular formula | C22H21F3N6O2 |
|---|---|
| Molecular weight | 458.4 g/mol |
| IUPAC name | N-[2-[[2-[(2-methoxy-5-methyl-4-pyridinyl)amino]-5-(trifluoromethyl)pyrimidin-4-yl]amino]-5-methylphenyl]prop-2-enamide |
| InChIKey | ILUKRINUNLAVMH-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)NC2=NC(=NC=C2C(F)(F)F)NC3=CC(=NC=C3C)OC)NC(=O)C=C |
Computed by PubChem (NCBI)