CAS 1207113-88-9 appears in our catalog under these names: CCG-100602/ 99.86% (existing batch purity), CCG–100602, CCG-100602, CCG-100602, 99.29%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 25 mg.
1-[3,5-bis(trifluoromethyl)benzoyl]-N-(4-chlorophenyl)piperidine-3-carboxamide (CAS 1207113-88-9) is a chemical compound with the molecular formula C21H17ClF6N2O2 and a molecular weight of 478.8 g/mol. IUPAC name: 1-[3,5-bis(trifluoromethyl)benzoyl]-N-(4-chlorophenyl)piperidine-3-carboxamide. InChIKey: MOQCFMZWVKQBAP-UHFFFAOYSA-N.
| Molecular formula | C21H17ClF6N2O2 |
|---|---|
| Molecular weight | 478.8 g/mol |
| IUPAC name | 1-[3,5-bis(trifluoromethyl)benzoyl]-N-(4-chlorophenyl)piperidine-3-carboxamide |
| InChIKey | MOQCFMZWVKQBAP-UHFFFAOYSA-N |
| SMILES | C1CC(CN(C1)C(=O)C2=CC(=CC(=C2)C(F)(F)F)C(F)(F)F)C(=O)NC3=CC=C(C=C3)Cl |
Computed by PubChem (NCBI)