CAS 423741-32-6 appears in our catalog under these names: CCG-13514/ 99.14% (existing batch purity), CCG-13514. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
[4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-phenylphenyl)methanone (CAS 423741-32-6) is a chemical compound with the molecular formula C25H25BrN2O2 and a molecular weight of 465.4 g/mol. IUPAC name: [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-phenylphenyl)methanone. InChIKey: SQRJNNLFOCKJRZ-UHFFFAOYSA-N.
| Molecular formula | C25H25BrN2O2 |
|---|---|
| Molecular weight | 465.4 g/mol |
| IUPAC name | [4-[(5-bromo-2-methoxyphenyl)methyl]piperazin-1-yl]-(4-phenylphenyl)methanone |
| InChIKey | SQRJNNLFOCKJRZ-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)Br)CN2CCN(CC2)C(=O)C3=CC=C(C=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)