CAS 1922098-69-8 appears in our catalog under these names: CCG-222740/ 98.79% (existing batch purity), CCG–222740, CCG-222740, N-(4-Chlorophenyl)-5,5-difluoro-1-(3-(furan-2-yl)benzoyl)piperidine-3-carboxamide, 98%, 98%, CCG-222740, 99.53%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 50 mg.
N-(4-chlorophenyl)-5,5-difluoro-1-[3-(furan-2-yl)benzoyl]piperidine-3-carboxamide (CAS 1922098-69-8) is a chemical compound with the molecular formula C23H19ClF2N2O3 and a molecular weight of 444.9 g/mol. IUPAC name: N-(4-chlorophenyl)-5,5-difluoro-1-[3-(furan-2-yl)benzoyl]piperidine-3-carboxamide. InChIKey: PMTPYUTZAJWGPE-UHFFFAOYSA-N.
| Molecular formula | C23H19ClF2N2O3 |
|---|---|
| Molecular weight | 444.9 g/mol |
| IUPAC name | N-(4-chlorophenyl)-5,5-difluoro-1-[3-(furan-2-yl)benzoyl]piperidine-3-carboxamide |
| InChIKey | PMTPYUTZAJWGPE-UHFFFAOYSA-N |
| SMILES | C1C(CN(CC1(F)F)C(=O)C2=CC=CC(=C2)C3=CC=CO3)C(=O)NC4=CC=C(C=C4)Cl |
Computed by PubChem (NCBI)