CAS 292053-42-0 appears in our catalog under these names: CCI-006/ 96.04% (existing batch purity), CCI–006, CCI-006, CCI-006 99%, CCI-006, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
Methyl (E)-2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate (CAS 292053-42-0) is a chemical compound with the molecular formula C15H12N2O5S and a molecular weight of 332.3 g/mol. IUPAC name: methyl (E)-2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate. InChIKey: VEXAKEBSBMAIOB-DHZHZOJOSA-N.
| Molecular formula | C15H12N2O5S |
|---|---|
| Molecular weight | 332.3 g/mol |
| IUPAC name | methyl (E)-2-cyano-3-[5-(4-sulfamoylphenyl)furan-2-yl]prop-2-enoate |
| InChIKey | VEXAKEBSBMAIOB-DHZHZOJOSA-N |
| SMILES | COC(=O)/C(=C/C1=CC=C(O1)C2=CC=C(C=C2)S(=O)(=O)N)/C#N |
Computed by PubChem (NCBI)