CAS 879399-82-3 appears in our catalog under these names: CCR3 antagonist 1/ 99.85% (existing batch purity), CCR3 antagonist 1, CCR3 antagonist 1 99%, CCR3 antagonist 1, CCR3 antagonist 1, 99.90%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 5 mg.
2-[2-[2-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid (CAS 879399-82-3) is a chemical compound with the molecular formula C19H21Cl2N3O4S2 and a molecular weight of 490.4 g/mol. IUPAC name: 2-[2-[2-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid. InChIKey: QBXNXHODSIQDRT-AWEZNQCLSA-N.
| Molecular formula | C19H21Cl2N3O4S2 |
|---|---|
| Molecular weight | 490.4 g/mol |
| IUPAC name | 2-[2-[2-[[(2S)-4-[(3,4-dichlorophenyl)methyl]morpholin-2-yl]methylamino]-2-oxoethyl]sulfanyl-1,3-thiazol-4-yl]acetic acid |
| InChIKey | QBXNXHODSIQDRT-AWEZNQCLSA-N |
| SMILES | C1CO[C@H](CN1CC2=CC(=C(C=C2)Cl)Cl)CNC(=O)CSC3=NC(=CS3)CC(=O)O |
Computed by PubChem (NCBI)