CAS 176957-55-4 appears in our catalog under these names: CCT007093/ 99.75% (existing batch purity), CCT007093, CCT 007093, CCT007093 99%, (2E,5E)-2,5-Bis(thiophen-2-ylmethylene)cyclopentan-1-one, 98%, 98%. Offered by: TargetMol, GLPBio, Biosynth, Ambeed, Sigma-Aldrich. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg, 1g.
(2E,5E)-2,5-bis(thiophen-2-ylmethylidene)cyclopentan-1-one (CAS 176957-55-4) is a chemical compound with the molecular formula C15H12OS2 and a molecular weight of 272.4 g/mol. IUPAC name: (2E,5E)-2,5-bis(thiophen-2-ylmethylidene)cyclopentan-1-one. InChIKey: KPFZCKDPBMGECB-WGDLNXRISA-N.
| Molecular formula | C15H12OS2 |
|---|---|
| Molecular weight | 272.4 g/mol |
| IUPAC name | (2E,5E)-2,5-bis(thiophen-2-ylmethylidene)cyclopentan-1-one |
| InChIKey | KPFZCKDPBMGECB-WGDLNXRISA-N |
| SMILES | C1/C(=C\C2=CC=CS2)/C(=O)/C(=C/C3=CC=CS3)/C1 |
Computed by PubChem (NCBI)