CAS 170355-78-9 appears in our catalog under these names: CD 2665, CD2665/ 99.67% (existing batch purity), CD 2665, 4-(6-(Adamantan-1-yl)-7-((2-methoxyethoxy)methoxy)naphthalen-2-yl)benzoic acid, CD2665, 99.68%. Offered by: TRC, TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 500mg, 1mg, 5mg, 10mg, 25mg, 10mM (in 1ml dmso), 10 mg, 25 mg.
4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoic acid (CAS 170355-78-9) is a chemical compound with the molecular formula C31H34O5 and a molecular weight of 486.6 g/mol. IUPAC name: 4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoic acid. InChIKey: JBALRFFXKQPVLT-UHFFFAOYSA-N.
| Molecular formula | C31H34O5 |
|---|---|
| Molecular weight | 486.6 g/mol |
| IUPAC name | 4-[7-(1-adamantyl)-6-(2-methoxyethoxymethoxy)naphthalen-2-yl]benzoic acid |
| InChIKey | JBALRFFXKQPVLT-UHFFFAOYSA-N |
| SMILES | COCCOCOC1=C(C=C2C=C(C=CC2=C1)C3=CC=C(C=C3)C(=O)O)C45CC6CC(C4)CC(C6)C5 |
Computed by PubChem (NCBI)