CAS 2132396-40-6 appears in our catalog under these names: CD73-IN-1/ 99.46% (existing batch purity), CD73–IN–1, CD73-IN-1, CD73-IN-1, 98.77%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 10mM (in 1ml dmso), 25mg, 50mg, 1 mg.
5-[(2-cyclopropyl-1H-indol-6-yl)sulfamoyl]-2-hydroxybenzamide (CAS 2132396-40-6) is a chemical compound with the molecular formula C18H17N3O4S and a molecular weight of 371.4 g/mol. IUPAC name: 5-[(2-cyclopropyl-1H-indol-6-yl)sulfamoyl]-2-hydroxybenzamide. InChIKey: YUGALILHRFUCAY-UHFFFAOYSA-N.
| Molecular formula | C18H17N3O4S |
|---|---|
| Molecular weight | 371.4 g/mol |
| IUPAC name | 5-[(2-cyclopropyl-1H-indol-6-yl)sulfamoyl]-2-hydroxybenzamide |
| InChIKey | YUGALILHRFUCAY-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC3=C(N2)C=C(C=C3)NS(=O)(=O)C4=CC(=C(C=C4)O)C(=O)N |
Computed by PubChem (NCBI)