cas: 59016-56-7 — see every product listed under this CAS number, including other names
CDAP 95% (CAS 59016-56-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A459355-100mg |
| cas | 59016-56-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 142.31 Pln | |
| Ambeed | 250mg | 159.00 Pln | |
| Ambeed | 1g | 409.31 Pln | |
| Ambeed | 5g | 1327.12 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A459355 |
4-(dimethylamino)pyridin-1-ium-1-carbonitrile tetrafluoroborate (CAS 59016-56-7) is a chemical compound with the molecular formula C8H10BF4N3 and a molecular weight of 234.99 g/mol. IUPAC name: 4-(dimethylamino)pyridin-1-ium-1-carbonitrile tetrafluoroborate. InChIKey: MBLVMDCQDCVKNE-UHFFFAOYSA-N.
| Molecular formula | C8H10BF4N3 |
|---|---|
| Molecular weight | 234.99 g/mol |
| IUPAC name | 4-(dimethylamino)pyridin-1-ium-1-carbonitrile tetrafluoroborate |
| InChIKey | MBLVMDCQDCVKNE-UHFFFAOYSA-N |
| SMILES | [B-](F)(F)(F)F.CN(C)C1=CC=[N+](C=C1)C#N |
Computed by PubChem (NCBI)