CAS 3048655-03-1 is the registry number for CDC14A/B-IN-1. Offered by: MedChemExpress. Available pack sizes: Get quote.
[difluoro-[4-(1-phenylethenyl)dibenzofuran-1-yl]methyl]phosphonic acid (CAS 3048655-03-1) is a chemical compound with the molecular formula C21H15F2O4P and a molecular weight of 400.3 g/mol. IUPAC name: [difluoro-[4-(1-phenylethenyl)dibenzofuran-1-yl]methyl]phosphonic acid. InChIKey: FABFVSJJDHFUMQ-UHFFFAOYSA-N.
| Molecular formula | C21H15F2O4P |
|---|---|
| Molecular weight | 400.3 g/mol |
| IUPAC name | [difluoro-[4-(1-phenylethenyl)dibenzofuran-1-yl]methyl]phosphonic acid |
| InChIKey | FABFVSJJDHFUMQ-UHFFFAOYSA-N |
| SMILES | C=C(C1=CC=CC=C1)C2=C3C(=C(C=C2)C(F)(F)P(=O)(O)O)C4=CC=CC=C4O3 |
Computed by PubChem (NCBI)