CAS 1256963-02-6 appears in our catalog under these names: CDK 4/6 Inhibitor, CDK 4/6 Inhibitor-D6, CDK4 inhibitor, CDK4-IN-1. Offered by: TRC, Biosynth, GLPBio, MedChemExpress. Available pack sizes: 250mg, 50mg, 25mg, 100mg, 10mg, 5mg, Get quote.
4-(3-chloro-5-propan-2-yl-1H-pyrazol-4-yl)-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]pyrimidin-2-amine (CAS 1256963-02-6) is a chemical compound with the molecular formula C22H29ClN8 and a molecular weight of 441.0 g/mol. IUPAC name: 4-(3-chloro-5-propan-2-yl-1H-pyrazol-4-yl)-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]pyrimidin-2-amine. InChIKey: JKFGTURSEBTJIZ-UHFFFAOYSA-N.
| Molecular formula | C22H29ClN8 |
|---|---|
| Molecular weight | 441.0 g/mol |
| IUPAC name | 4-(3-chloro-5-propan-2-yl-1H-pyrazol-4-yl)-N-[5-[4-(dimethylamino)piperidin-1-yl]-2-pyridinyl]pyrimidin-2-amine |
| InChIKey | JKFGTURSEBTJIZ-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C(=NN1)Cl)C2=NC(=NC=C2)NC3=NC=C(C=C3)N4CCC(CC4)N(C)C |
Computed by PubChem (NCBI)