CAS 1269815-17-9 appears in our catalog under these names: CDK inhibitor II, CDK-IN-2/ 99.52% (existing batch purity), (R)-N-(5-Chloro-4-(5-fluoro-2-methoxyphenyl)pyridin-2-yl)piperidine-3-carboxamide, 99%, 99%, CDK-IN-2, 99.27%. Offered by: GLPBio, TargetMol, Chemat, MedChemExpress. Available pack sizes: 10mg, 25mg, 5mg, 50mg, 1mg, 2mg, 100mg, 500mg.
(3R)-N-[5-chloro-4-(5-fluoro-2-methoxyphenyl)-2-pyridinyl]piperidine-3-carboxamide (CAS 1269815-17-9) is a chemical compound with the molecular formula C18H19ClFN3O2 and a molecular weight of 363.8 g/mol. IUPAC name: (3R)-N-[5-chloro-4-(5-fluoro-2-methoxyphenyl)-2-pyridinyl]piperidine-3-carboxamide. InChIKey: AHMKHNVZGOQLRQ-LLVKDONJSA-N.
| Molecular formula | C18H19ClFN3O2 |
|---|---|
| Molecular weight | 363.8 g/mol |
| IUPAC name | (3R)-N-[5-chloro-4-(5-fluoro-2-methoxyphenyl)-2-pyridinyl]piperidine-3-carboxamide |
| InChIKey | AHMKHNVZGOQLRQ-LLVKDONJSA-N |
| SMILES | COC1=C(C=C(C=C1)F)C2=CC(=NC=C2Cl)NC(=O)[C@@H]3CCCNC3 |
Computed by PubChem (NCBI)