CAS 2459916-56-2 appears in our catalog under these names: CDK1/Cyc B–IN–1, CDK1/Cyc B-IN-1, 98.47%. Offered by: GLPBio, MedChemExpress. Available pack sizes: 10mg, 100mg, 25mg, 5mg, 50mg, 100 mg, 5 mg, 10 mg.
7-chloro-3-(2,4-dimethoxyphenyl)-5-methyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione (CAS 2459916-56-2) is a chemical compound with the molecular formula C14H12ClN3O2S2 and a molecular weight of 353.8 g/mol. IUPAC name: 7-chloro-3-(2,4-dimethoxyphenyl)-5-methyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione. InChIKey: NNKYAHQQRCIKAG-UHFFFAOYSA-N.
| Molecular formula | C14H12ClN3O2S2 |
|---|---|
| Molecular weight | 353.8 g/mol |
| IUPAC name | 7-chloro-3-(2,4-dimethoxyphenyl)-5-methyl-[1,3]thiazolo[4,5-d]pyrimidine-2-thione |
| InChIKey | NNKYAHQQRCIKAG-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C(=N1)Cl)SC(=S)N2C3=C(C=C(C=C3)OC)OC |
Computed by PubChem (NCBI)