CAS 220749-41-7 appears in our catalog under these names: CDK1-IN-2/ 98.41% (existing batch purity), CDK1–IN–2, 3-((2-Chloro-1H-indol-3-yl)methylene)indolin-2-one, 97%, 97%, CDK1-IN-2, 98.89%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 10 mg.
3-[(2-chloro-1H-indol-3-yl)methylidene]-1H-indol-2-one (CAS 220749-41-7) is a chemical compound with the molecular formula C17H11ClN2O and a molecular weight of 294.7 g/mol. IUPAC name: 3-[(2-chloro-1H-indol-3-yl)methylidene]-1H-indol-2-one. InChIKey: QJKBRWSJWQVKLY-UHFFFAOYSA-N.
| Molecular formula | C17H11ClN2O |
|---|---|
| Molecular weight | 294.7 g/mol |
| IUPAC name | 3-[(2-chloro-1H-indol-3-yl)methylidene]-1H-indol-2-one |
| InChIKey | QJKBRWSJWQVKLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC3=C(NC4=CC=CC=C43)Cl)C(=O)N2 |
Computed by PubChem (NCBI)