CAS 2079895-42-2 appears in our catalog under these names: CDK2-IN-4/ 97.24% (existing batch purity), CDK2-IN-4, CDK2-IN-4 98%, CDK2 inhibitor 73, 98%, 98%, CDK2-IN-4, 99.85%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10 mg, 1 mg.
4-[[6-(3-phenylphenyl)-7H-purin-2-yl]amino]benzenesulfonamide (CAS 2079895-42-2) is a chemical compound with the molecular formula C23H18N6O2S and a molecular weight of 442.5 g/mol. IUPAC name: 4-[[6-(3-phenylphenyl)-7H-purin-2-yl]amino]benzenesulfonamide. InChIKey: FUGRWXRQJGJIER-UHFFFAOYSA-N.
| Molecular formula | C23H18N6O2S |
|---|---|
| Molecular weight | 442.5 g/mol |
| IUPAC name | 4-[[6-(3-phenylphenyl)-7H-purin-2-yl]amino]benzenesulfonamide |
| InChIKey | FUGRWXRQJGJIER-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC(=CC=C2)C3=C4C(=NC(=N3)NC5=CC=C(C=C5)S(=O)(=O)N)N=CN4 |
Computed by PubChem (NCBI)