CAS 1257704-57-6 appears in our catalog under these names: CEP-33779/ 98.81% (existing batch purity), CEP–33779, CEP 33779, CEP-33779, CEP-33779, 99%, 99%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso).
N-[3-(4-methylpiperazin-1-yl)phenyl]-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (CAS 1257704-57-6) is a chemical compound with the molecular formula C24H26N6O2S and a molecular weight of 462.6 g/mol. IUPAC name: N-[3-(4-methylpiperazin-1-yl)phenyl]-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine. InChIKey: RFZKSQIFOZZIAQ-UHFFFAOYSA-N.
| Molecular formula | C24H26N6O2S |
|---|---|
| Molecular weight | 462.6 g/mol |
| IUPAC name | N-[3-(4-methylpiperazin-1-yl)phenyl]-8-(4-methylsulfonylphenyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| InChIKey | RFZKSQIFOZZIAQ-UHFFFAOYSA-N |
| SMILES | CN1CCN(CC1)C2=CC=CC(=C2)NC3=NN4C=CC=C(C4=N3)C5=CC=C(C=C5)S(=O)(=O)C |
Computed by PubChem (NCBI)