CAS 331458-02-7 appears in our catalog under these names: CFM 4/ 98.82% (existing batch purity), CFM 4, CFM 4, 1-[(2-Chlorophenyl)methyl]-5'-phenylspiro[3H-indole-3,2'(3'H)-[1,3,4]thiadiazol]-2(1H)-one, 95%, 95%, CFM-4, 98.85%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 250mg.
1'-[(2-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one (CAS 331458-02-7) is a chemical compound with the molecular formula C22H16ClN3OS and a molecular weight of 405.9 g/mol. IUPAC name: 1'-[(2-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one. InChIKey: PMADITKBVODKSF-UHFFFAOYSA-N.
| Molecular formula | C22H16ClN3OS |
|---|---|
| Molecular weight | 405.9 g/mol |
| IUPAC name | 1'-[(2-chlorophenyl)methyl]-5-phenylspiro[3H-1,3,4-thiadiazole-2,3'-indole]-2'-one |
| InChIKey | PMADITKBVODKSF-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=NNC3(S2)C4=CC=CC=C4N(C3=O)CC5=CC=CC=C5Cl |
Computed by PubChem (NCBI)