CAS 910232-84-7 appears in our catalog under these names: CGI-1746/ 98.27% (existing batch purity), CGI–1746, GCI1746, CGI1746, 95%, CGI-1746 98%. Offered by: TargetMol, GLPBio, Chemat, Thermo Scientific (Acros), Ambeed. Available pack sizes: 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 1mg.
4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(morpholine-4-carbonyl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide (CAS 910232-84-7) is a chemical compound with the molecular formula C34H37N5O4 and a molecular weight of 579.7 g/mol. IUPAC name: 4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(morpholine-4-carbonyl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide. InChIKey: JIFCFQDXHMUPGP-UHFFFAOYSA-N.
| Molecular formula | C34H37N5O4 |
|---|---|
| Molecular weight | 579.7 g/mol |
| IUPAC name | 4-tert-butyl-N-[2-methyl-3-[4-methyl-6-[4-(morpholine-4-carbonyl)anilino]-5-oxopyrazin-2-yl]phenyl]benzamide |
| InChIKey | JIFCFQDXHMUPGP-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC=C1NC(=O)C2=CC=C(C=C2)C(C)(C)C)C3=CN(C(=O)C(=N3)NC4=CC=C(C=C4)C(=O)N5CCOCC5)C |
Computed by PubChem (NCBI)