CAS 1007207-67-1 appears in our catalog under these names: CH5132799/ 99.87% (existing batch purity), CH5132799, Izorlisib 99%, CH5132799, 99%, 99%, Izorlisib, 99.01%. Offered by: TargetMol, GLPBio, Chemat, Ambeed, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg.
5-(7-methylsulfonyl-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-2-amine (CAS 1007207-67-1) is a chemical compound with the molecular formula C15H19N7O3S and a molecular weight of 377.4 g/mol. IUPAC name: 5-(7-methylsulfonyl-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-2-amine. InChIKey: JEGHXKRHKHPBJD-UHFFFAOYSA-N.
| Molecular formula | C15H19N7O3S |
|---|---|
| Molecular weight | 377.4 g/mol |
| IUPAC name | 5-(7-methylsulfonyl-2-morpholin-4-yl-5,6-dihydropyrrolo[2,3-d]pyrimidin-4-yl)pyrimidin-2-amine |
| InChIKey | JEGHXKRHKHPBJD-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)N1CCC2=C(N=C(N=C21)N3CCOCC3)C4=CN=C(N=C4)N |
Computed by PubChem (NCBI)