cas: 98991-32-3 — see every product listed under this CAS number, including other names
CHBO4 97% (CAS 98991-32-3) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A301382-5mg |
| cas | 98991-32-3 |
| size | 5mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5mg | 175.69 Pln | |
| Ambeed | 10mg | 203.50 Pln | |
| Ambeed | 25mg | 231.31 Pln | |
| Ambeed | 50mg | 270.25 Pln | |
| Ambeed | 100mg | 309.19 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 898.81 Pln | |
| Ambeed | 5g | 2968.06 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A301382 |
1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one (CAS 98991-32-3) is a chemical compound with the molecular formula C15H10BrFO and a molecular weight of 305.14 g/mol. IUPAC name: 1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one. InChIKey: JLKQXQSMJJGERH-UHFFFAOYSA-N.
| Molecular formula | C15H10BrFO |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | JLKQXQSMJJGERH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC(=O)C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)