CAS 98991-32-3 appears in our catalog under these names: CHBO4/ 98.14% (existing batch purity), 4-Fluoro-4'-bromochalcone, CHBO4, CHBO4, 97%. Offered by: TargetMol, Chemat, MedChemExpress, Ambeed. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one (CAS 98991-32-3) is a chemical compound with the molecular formula C15H10BrFO and a molecular weight of 305.14 g/mol. IUPAC name: 1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one. InChIKey: JLKQXQSMJJGERH-UHFFFAOYSA-N.
| Molecular formula | C15H10BrFO |
|---|---|
| Molecular weight | 305.14 g/mol |
| IUPAC name | 1-(4-bromophenyl)-3-(4-fluorophenyl)prop-2-en-1-one |
| InChIKey | JLKQXQSMJJGERH-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C=CC(=O)C2=CC=C(C=C2)Br)F |
Computed by PubChem (NCBI)