CAS 1629729-98-1 appears in our catalog under these names: CHDI-390576 98%, 2-(2-Fluorophenyl)-N-hydroxy-2-(4-(5-(trifluoromethyl)pyrimidin-2-yl)phenyl)acetamide, 98%, 98%, CHDI-390576/ 98.35% (existing batch purity), CHDI–390576, CHDI 00390576. Offered by: Ambeed, Chemat, TargetMol, GLPBio, Biosynth. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 10 mg.
2-(2-fluorophenyl)-N-hydroxy-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]phenyl]acetamide (CAS 1629729-98-1) is a chemical compound with the molecular formula C19H13F4N3O2 and a molecular weight of 391.3 g/mol. IUPAC name: 2-(2-fluorophenyl)-N-hydroxy-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]phenyl]acetamide. InChIKey: LMGDHGQJJLEAPQ-UHFFFAOYSA-N.
| Molecular formula | C19H13F4N3O2 |
|---|---|
| Molecular weight | 391.3 g/mol |
| IUPAC name | 2-(2-fluorophenyl)-N-hydroxy-2-[4-[5-(trifluoromethyl)pyrimidin-2-yl]phenyl]acetamide |
| InChIKey | LMGDHGQJJLEAPQ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C(C2=CC=C(C=C2)C3=NC=C(C=N3)C(F)(F)F)C(=O)NO)F |
Computed by PubChem (NCBI)