CAS 1458630-17-5 appears in our catalog under these names: CHR 6494 trifluoroacetate, CHR-6494 TFA/ 99.1% (existing batch purity), CHR 6494 trifluoroacetate, CHR-6494 TFA 97%, 3-(1H-Indazol-5-yl)-N-propylimidazo[1,2-b]pyridazin-6-amine 2,2,2-trifluoroacetate, 97%, 97%. Offered by: GLPBio, TargetMol, Biosynth, Ambeed, Chemat. Available pack sizes: 10mg, 1mg, 5mg, 25mg, 50mg, 100mg, 200mg, 250mg.
3-(1H-indazol-5-yl)-N-propylimidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid (CAS 1458630-17-5) is a chemical compound with the molecular formula C18H17F3N6O2 and a molecular weight of 406.4 g/mol. IUPAC name: 3-(1H-indazol-5-yl)-N-propylimidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid. InChIKey: ILWYDZNXJQESDI-UHFFFAOYSA-N.
| Molecular formula | C18H17F3N6O2 |
|---|---|
| Molecular weight | 406.4 g/mol |
| IUPAC name | 3-(1H-indazol-5-yl)-N-propylimidazo[1,2-b]pyridazin-6-amine;2,2,2-trifluoroacetic acid |
| InChIKey | ILWYDZNXJQESDI-UHFFFAOYSA-N |
| SMILES | CCCNC1=NN2C(=NC=C2C3=CC4=C(C=C3)NN=C4)C=C1.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)