CAS 212631-79-3 appears in our catalog under these names: CI-1040/ 99.1% (existing batch purity), PD184352 (CI–1040), PD184352, PD 184352, PD 184352 [Optimized for Cell Culture]. Offered by: TargetMol, GLPBio, Chemat, Biosynth, TCI. Available pack sizes: 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 10mM (in 1ml dmso), 1mg.
2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide (CAS 212631-79-3) is a chemical compound with the molecular formula C17H14ClF2IN2O2 and a molecular weight of 478.7 g/mol. IUPAC name: 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide. InChIKey: GFMMXOIFOQCCGU-UHFFFAOYSA-N.
| Molecular formula | C17H14ClF2IN2O2 |
|---|---|
| Molecular weight | 478.7 g/mol |
| IUPAC name | 2-(2-chloro-4-iodoanilino)-N-(cyclopropylmethoxy)-3,4-difluorobenzamide |
| InChIKey | GFMMXOIFOQCCGU-UHFFFAOYSA-N |
| SMILES | C1CC1CONC(=O)C2=C(C(=C(C=C2)F)F)NC3=C(C=C(C=C3)I)Cl |
Computed by PubChem (NCBI)