Products 834903-43-4
CAS 834903-43-4 appears in our catalog under these names: 4-[4,6-Dihydro-4-(3-hydroxyphenyl)-3-(4-methylphenyl)-6-oxopyrrolo[3,4-c]pyrazol-5(1H)-yl]benzoic acid, 98%, 98%, CID 16020046/ 99.59% (existing batch purity), CID 16020046, CID 16020046 98%, CID 16020046, 99.81%. Offered by: Chemat, TargetMol, Biosynth, Ambeed, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 50mg, 2mg, 25mg, 100mg, 250mg.
4-[4-(3-hydroxyphenyl)-3-(4-methylphenyl)-6-oxo-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]benzoic acid (CAS 834903-43-4) is a chemical compound with the molecular formula C25H19N3O4 and a molecular weight of 425.4 g/mol. IUPAC name: 4-[4-(3-hydroxyphenyl)-3-(4-methylphenyl)-6-oxo-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]benzoic acid. InChIKey: VGUQVYZXABOXCX-UHFFFAOYSA-N.
| Molecular formula | C25H19N3O4 |
|---|---|
| Molecular weight | 425.4 g/mol |
| IUPAC name | 4-[4-(3-hydroxyphenyl)-3-(4-methylphenyl)-6-oxo-1,4-dihydropyrrolo[3,4-d]pyrazol-5-yl]benzoic acid |
| InChIKey | VGUQVYZXABOXCX-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NNC3=C2C(N(C3=O)C4=CC=C(C=C4)C(=O)O)C5=CC(=CC=C5)O |
Computed by PubChem (NCBI)