CAS 681173-76-2 appears in our catalog under these names: CID-5056270/ 99.57% (existing batch purity), CID-5056270, ROCK2-IN-8, 99.85%. Offered by: TargetMol, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 200mg, 25 mg.
N-(4-pyridin-4-yl-1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide (CAS 681173-76-2) is a chemical compound with the molecular formula C17H13N3O3S and a molecular weight of 339.4 g/mol. IUPAC name: N-(4-pyridin-4-yl-1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide. InChIKey: QKKGSTFAKMXWFE-UHFFFAOYSA-N.
| Molecular formula | C17H13N3O3S |
|---|---|
| Molecular weight | 339.4 g/mol |
| IUPAC name | N-(4-pyridin-4-yl-1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzodioxine-3-carboxamide |
| InChIKey | QKKGSTFAKMXWFE-UHFFFAOYSA-N |
| SMILES | C1C(OC2=CC=CC=C2O1)C(=O)NC3=NC(=CS3)C4=CC=NC=C4 |
Computed by PubChem (NCBI)