cas: 71666-05-2 — see every product listed under this CAS number, including other names
CIS-1,2-CYCLOPROPANE-DICARBOXYLIC ACID MONO ETHYL ESTER, 95% (CAS 71666-05-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387871-250MG |
| cas | 71666-05-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1471.37 Pln | |
| Fluorochem | 1g | 3736.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
Cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid (CAS 71666-05-2) is a chemical compound with the molecular formula C7H10O4 and a molecular weight of 158.15 g/mol. IUPAC name: cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid. InChIKey: BRVQFDJETHFEQY-CRCLSJGQSA-N.
| Molecular formula | C7H10O4 |
|---|---|
| Molecular weight | 158.15 g/mol |
| IUPAC name | cis-(1S,2R)-2-ethoxycarbonylcyclopropane-1-carboxylic acid |
| InChIKey | BRVQFDJETHFEQY-CRCLSJGQSA-N |
| SMILES | CCOC(=O)[C@@H]1C[C@@H]1C(=O)O |
Computed by PubChem (NCBI)