cas: 370879-56-4 — see every product listed under this CAS number, including other names
CIS-5-BENZYL-2-BOC-HEXAHYDROPYRROLO[3,4-C]PYRROLE, 97%, 97% (CAS 370879-56-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11C8NI-100mg |
| cas | 370879-56-4 |
| size | 100mg |
| availability | 0.75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 750.80 Pln | |
| Chemat | 250mg | 1216.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate (CAS 370879-56-4) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl (3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate. InChIKey: WUEVXPVJRUPJLC-IYBDPMFKSA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl (3aS,6aR)-2-benzyl-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-5-carboxylate |
| InChIKey | WUEVXPVJRUPJLC-IYBDPMFKSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H]2CN(C[C@H]2C1)CC3=CC=CC=C3 |
Computed by PubChem (NCBI)