Products 1330766-05-6
CAS 1330766-05-6 is the registry number for Racemic-(4r,5s)-tert-butyl 4-phenyl-2,7-diazaspiro[4.4]nonane-2-carboxylate, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
Tert-butyl (4R,5S)-4-phenyl-2,7-diazaspiro[4.4]nonane-2-carboxylate (CAS 1330766-05-6) is a chemical compound with the molecular formula C18H26N2O2 and a molecular weight of 302.4 g/mol. IUPAC name: tert-butyl (4R,5S)-4-phenyl-2,7-diazaspiro[4.4]nonane-2-carboxylate. InChIKey: SZRJUSMARDPBID-QAPCUYQASA-N.
| Molecular formula | C18H26N2O2 |
|---|---|
| Molecular weight | 302.4 g/mol |
| IUPAC name | tert-butyl (4R,5S)-4-phenyl-2,7-diazaspiro[4.4]nonane-2-carboxylate |
| InChIKey | SZRJUSMARDPBID-QAPCUYQASA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@@H]([C@@]2(C1)CCNC2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)