CK-274, 99%, 99%
cas: 2364554-48-1 — see every product listed under this CAS number, including other names
CK-274, 99%, 99% (CAS 2364554-48-1) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12X23A-1mg |
| cas | 2364554-48-1 |
| size | 1mg |
| availability | 3g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 1mg | 381.20 Pln | |
| Chemat | 5mg | 818.00 Pln | |
| Chemat | 10mg | 1274.00 Pln | |
| Chemat | 25mg | 2253.20 Pln | |
| Chemat | 50mg | 3194.00 Pln | |
| Chemat | 100mg | 4134.80 Pln | |
| Chemat | 250mg | 6170.00 Pln | |
| Chemat | 1g | 12342.80 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methylpyrazole-4-carboxamide (CAS 2364554-48-1) is a chemical compound with the molecular formula C18H19N5O2 and a molecular weight of 337.4 g/mol. IUPAC name: N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methylpyrazole-4-carboxamide. InChIKey: IOVAZWDIRCRMTM-OAHLLOKOSA-N.
| Molecular formula | C18H19N5O2 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methylpyrazole-4-carboxamide |
| InChIKey | IOVAZWDIRCRMTM-OAHLLOKOSA-N |
| SMILES | CCC1=NC(=NO1)C2=CC3=C(C=C2)[C@@H](CC3)NC(=O)C4=CN(N=C4)C |
Computed by PubChem (NCBI)