Products 2364554-48-1
CAS 2364554-48-1 appears in our catalog under these names: Aficamten, Aficamten/ 99.39% (existing batch purity), Aficamten 99%, CK-274, 99%, 99%, Aficamten, 99.86%. Offered by: GLPBio, TRC, TargetMol, Ambeed, Chemat. Available pack sizes: 1mg, 500mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso).
N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methylpyrazole-4-carboxamide (CAS 2364554-48-1) is a chemical compound with the molecular formula C18H19N5O2 and a molecular weight of 337.4 g/mol. IUPAC name: N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methylpyrazole-4-carboxamide. InChIKey: IOVAZWDIRCRMTM-OAHLLOKOSA-N.
| Molecular formula | C18H19N5O2 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | N-[(1R)-5-(5-ethyl-1,2,4-oxadiazol-3-yl)-2,3-dihydro-1H-inden-1-yl]-1-methylpyrazole-4-carboxamide |
| InChIKey | IOVAZWDIRCRMTM-OAHLLOKOSA-N |
| SMILES | CCC1=NC(=NO1)C2=CC3=C(C=C2)[C@@H](CC3)NC(=O)C4=CN(N=C4)C |
Computed by PubChem (NCBI)