CAS 1784751-20-7 appears in our catalog under these names: CK1-IN-1/ 98.79% (existing batch purity), CK1-IN-1, CK1-IN-1 99%, 4-(2-(1-Fluoronaphthalen-2-yl)-5-(4-fluorophenyl)-1H-imidazol-4-yl)pyridine, 99%, 99%, CK1-IN-1, 99.19%. Offered by: TargetMol, Biosynth, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
4-[2-(1-fluoronaphthalen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine (CAS 1784751-20-7) is a chemical compound with the molecular formula C24H15F2N3 and a molecular weight of 383.4 g/mol. IUPAC name: 4-[2-(1-fluoronaphthalen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine. InChIKey: PUQAFIILJICJRR-UHFFFAOYSA-N.
| Molecular formula | C24H15F2N3 |
|---|---|
| Molecular weight | 383.4 g/mol |
| IUPAC name | 4-[2-(1-fluoronaphthalen-2-yl)-4-(4-fluorophenyl)-1H-imidazol-5-yl]pyridine |
| InChIKey | PUQAFIILJICJRR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=CC(=C2F)C3=NC(=C(N3)C4=CC=NC=C4)C5=CC=C(C=C5)F |
Computed by PubChem (NCBI)