CAS 1085822-09-8 appears in our catalog under these names: CK2/ERK8-IN-1/ 98.82% (existing batch purity), CK2/ERK8–IN–1, (4,5,6,7-Tetrabromo-2-(Dimethylamino)-1h-Benzimidazol-1-yl)acetic acid, TMCB, CK2/ERK8-IN-1, 99.0%. Offered by: TargetMol, GLPBio, Biosynth, Chemat, MedChemExpress. Available pack sizes: 5mg, 10mg, 100mg, 50mg, 25mg, 100 mg, 5 mg, 50 mg.
2-[4,5,6,7-tetrabromo-2-(dimethylamino)benzimidazol-1-yl]acetic acid (CAS 1085822-09-8) is a chemical compound with the molecular formula C11H9Br4N3O2 and a molecular weight of 534.82 g/mol. IUPAC name: 2-[4,5,6,7-tetrabromo-2-(dimethylamino)benzimidazol-1-yl]acetic acid. InChIKey: PHAOTASRLQMKBE-UHFFFAOYSA-N.
| Molecular formula | C11H9Br4N3O2 |
|---|---|
| Molecular weight | 534.82 g/mol |
| IUPAC name | 2-[4,5,6,7-tetrabromo-2-(dimethylamino)benzimidazol-1-yl]acetic acid |
| InChIKey | PHAOTASRLQMKBE-UHFFFAOYSA-N |
| SMILES | CN(C)C1=NC2=C(N1CC(=O)O)C(=C(C(=C2Br)Br)Br)Br |
Computed by PubChem (NCBI)