CAS 507487-89-0 appears in our catalog under these names: CK7/ 98.07% (existing batch purity), CK7, CK7, 99.72%. Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 500mg, 200mg.
4-methyl-5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine (CAS 507487-89-0) is a chemical compound with the molecular formula C14H12N6O2S and a molecular weight of 328.35 g/mol. IUPAC name: 4-methyl-5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine. InChIKey: DYTKVFHLKPDNRW-UHFFFAOYSA-N.
| Molecular formula | C14H12N6O2S |
|---|---|
| Molecular weight | 328.35 g/mol |
| IUPAC name | 4-methyl-5-[2-(3-nitroanilino)pyrimidin-4-yl]-1,3-thiazol-2-amine |
| InChIKey | DYTKVFHLKPDNRW-UHFFFAOYSA-N |
| SMILES | CC1=C(SC(=N1)N)C2=NC(=NC=C2)NC3=CC(=CC=C3)[N+](=O)[O-] |
Computed by PubChem (NCBI)