CAS 1542205-83-3 appears in our catalog under these names: CM-352/ 99.36% (existing batch purity), CM-352. Offered by: TargetMol, Chemat. Available pack sizes: 1mg, 5mg, 25mg, 50mg, 100mg, 10mg.
(3R)-N-hydroxy-3-[4-[4-(methylcarbamoyl)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide (CAS 1542205-83-3) is a chemical compound with the molecular formula C24H29N3O6S and a molecular weight of 487.6 g/mol. IUPAC name: (3R)-N-hydroxy-3-[4-[4-(methylcarbamoyl)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide. InChIKey: ZUZGJCNWNOCKEB-XMMPIXPASA-N.
| Molecular formula | C24H29N3O6S |
|---|---|
| Molecular weight | 487.6 g/mol |
| IUPAC name | (3R)-N-hydroxy-3-[4-[4-(methylcarbamoyl)phenoxy]phenyl]sulfonyl-8-azaspiro[4.5]decane-3-carboxamide |
| InChIKey | ZUZGJCNWNOCKEB-XMMPIXPASA-N |
| SMILES | CNC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)S(=O)(=O)[C@@]3(CCC4(C3)CCNCC4)C(=O)NO |
Computed by PubChem (NCBI)