CAS 2309409-79-6 appears in our catalog under these names: CMP-5 2HCl/ 98.84% (existing batch purity), CMP–5 2HCl, CMP-5 2HCl, CMP-5 (dihydrochloride). Offered by: TargetMol, GLPBio, Chemat, MedChemExpress. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 10mM (in 1ml dmso), 50 mg.
1-(9-ethylcarbazol-3-yl)-N-(pyridin-2-ylmethyl)methanamine;dihydrochloride (CAS 2309409-79-6) is a chemical compound with the molecular formula C21H23Cl2N3 and a molecular weight of 388.3 g/mol. IUPAC name: 1-(9-ethylcarbazol-3-yl)-N-(pyridin-2-ylmethyl)methanamine;dihydrochloride. InChIKey: VWDPNMAEGCNJGR-UHFFFAOYSA-N.
| Molecular formula | C21H23Cl2N3 |
|---|---|
| Molecular weight | 388.3 g/mol |
| IUPAC name | 1-(9-ethylcarbazol-3-yl)-N-(pyridin-2-ylmethyl)methanamine;dihydrochloride |
| InChIKey | VWDPNMAEGCNJGR-UHFFFAOYSA-N |
| SMILES | CCN1C2=C(C=C(C=C2)CNCC3=CC=CC=N3)C4=CC=CC=C41.Cl.Cl |
Computed by PubChem (NCBI)