CAS 1190932-38-7 appears in our catalog under these names: COH29/ 98.92% (existing batch purity), COH29, COH29 98+%, COH29, 98+%, 98+%, COH29, 98.76%. Offered by: TargetMol, GLPBio, Ambeed, Chemat, MedChemExpress. Available pack sizes: 1mg, 2mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg.
N-[4-(3,4-dihydroxyphenyl)-5-phenyl-1,3-thiazol-2-yl]-3,4-dihydroxybenzamide (CAS 1190932-38-7) is a chemical compound with the molecular formula C22H16N2O5S and a molecular weight of 420.4 g/mol. IUPAC name: N-[4-(3,4-dihydroxyphenyl)-5-phenyl-1,3-thiazol-2-yl]-3,4-dihydroxybenzamide. InChIKey: LGGDLPSXAGQFSG-UHFFFAOYSA-N.
| Molecular formula | C22H16N2O5S |
|---|---|
| Molecular weight | 420.4 g/mol |
| IUPAC name | N-[4-(3,4-dihydroxyphenyl)-5-phenyl-1,3-thiazol-2-yl]-3,4-dihydroxybenzamide |
| InChIKey | LGGDLPSXAGQFSG-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=C(N=C(S2)NC(=O)C3=CC(=C(C=C3)O)O)C4=CC(=C(C=C4)O)O |
Computed by PubChem (NCBI)